Paraoxon: Difference between revisions

| verifiedrevid = 402518942

| IUPAC_name = diethyl 4-nitrophenyl phosphate

| image = Paraoxon.svg

| CASNo_Ref = {{cascite|correct|CAS}}

| InChI = 1/C10H14NO6P/c1-3-15-18(14,16-4-2)17-10-7-5-9(6-8-10)11(12)13/h5-8H,3-4H2,1-2H3

| InChIKey = WYMSBXTXOHUIGT-UHFFFAOYAD

| smiles = [O-][N+](=O)c1ccc(OP(=O)(OCC)OCC)cc1

| CAS_number = 311-45-5

| ATC_prefix = S01

| ATC_suffix = EB10

| PubChem = 9395

| DrugBank =

| C=10|H=14|N=1|O=6|P=1

| molecular_weight = 275.195 g/mol

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_category=

| legal_status = Uncontrolled

| routes_of_administration =

'''Paraoxon''' is a [[parasympathomimetic]] which acts as an [[acetylcholinesterase inhibitor]]. It is an [[organophosphate]] [[Oxon (chemical)|oxon]], and the active [[metabolite]] of the insecticide [[parathion]]. It is also used as an [[opthalmological]] drug against [[glaucoma]]. Paraoxon is one of the most potent acetylcholinesterase-inhibiting insecticides available, around 70% as potent as the nerve agent [[sarin]], and so is now rarely used as an insecticide due to the risk of poisoning to humans and other animals. It is easily absorbed through skin, and was used as an assassination weapon by the apartheid-era South African chemical weapons program [[Project Coast]].<ref>[http://www.nti.org/e_research/profiles/SAfrica/Chemical/2440_3598.html NTI Country Overviews:South Africa:Chemical Capabilities:Paraoxon]</ref>

{{Opthalmologicals}}

{{Cholinergics}}

[[Category:Anticholinesterases]]

[[Category:Nitrobenzenes]]

[[cs:Paraoxon]]

[[de:Paraoxon]]

[[fr:Paraoxone]]

[[zh:對氧磷]]